C18H18O6S — CID 54753916
diethyl 4-(4-methoxybenzoyl)thiophene-2,3-dicarboxylate (PubChem CID 54753916) has the molecular formula C18H18O6S and a molecular weight of 362.40 g/mol. Its IUPAC name is diethyl 4-(4-methoxybenzoyl)thiophene-2,3-dicarboxylate.
| Compound Name | diethyl 4-(4-methoxybenzoyl)thiophene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 54753916 |
| Molecular Formula | C18H18O6S |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | diethyl 4-(4-methoxybenzoyl)thiophene-2,3-dicarboxylate |
| SMILES | CCOC(=O)c1scc(C(=O)c2ccc(OC)cc2)c1C(=O)OCC |
| InChI | InChI=1S/C18H18O6S/c1-4-23-17(20)14-13(10-25-16(14)18(21)24-5-2)15(19)11-6-8-12(22-3)9-7-11/h6-10H,4-5H2,1-3H3 |
| InChIKey | STFAYNKOPXQQMK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |