C27H20O6S3 — CID 11387087
diethyl 4,5-dibenzoyl-7-sulfanylidenethieno[2,3-c]thiopyran-2,3-dicarboxylate (PubChem CID 11387087) has the molecular formula C27H20O6S3 and a molecular weight of 536.65 g/mol. Its IUPAC name is diethyl 4,5-dibenzoyl-7-sulfanylidenethieno[2,3-c]thiopyran-2,3-dicarboxylate.
| Compound Name | diethyl 4,5-dibenzoyl-7-sulfanylidenethieno[2,3-c]thiopyran-2,3-dicarboxylate |
|---|---|
| PubChem CID | 11387087 |
| Molecular Formula | C27H20O6S3 |
| Molecular Weight | 536.65 g/mol |
| Exact Mass | 536.04 |
| IUPAC Name | diethyl 4,5-dibenzoyl-7-sulfanylidenethieno[2,3-c]thiopyran-2,3-dicarboxylate |
| SMILES | CCOC(=O)c1sc2c(=S)sc(C(=O)c3ccccc3)c(C(=O)c3ccccc3)c2c1C(=O)OCC |
| InChI | InChI=1S/C27H20O6S3/c1-3-32-25(30)19-17-18(20(28)15-11-7-5-8-12-15)22(21(29)16-13-9-6-10-14-16)36-27(34)24(17)35-23(19)26(31)33-4-2/h5-14H,3-4H2,1-2H3 |
| InChIKey | DLRSYKGGZXUEHJ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.65 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|