C29H26O5 — CID 71489624
ethyl 2-(4-methoxyphenyl)-4-(4-methylbenzoyl)-5-(4-methylphenyl)furan-3-carboxylate (PubChem CID 71489624) has the molecular formula C29H26O5 and a molecular weight of 454.52 g/mol. Its IUPAC name is ethyl 2-(4-methoxyphenyl)-4-(4-methylbenzoyl)-5-(4-methylphenyl)furan-3-carboxylate.
| Compound Name | ethyl 2-(4-methoxyphenyl)-4-(4-methylbenzoyl)-5-(4-methylphenyl)furan-3-carboxylate |
|---|---|
| PubChem CID | 71489624 |
| Molecular Formula | C29H26O5 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | ethyl 2-(4-methoxyphenyl)-4-(4-methylbenzoyl)-5-(4-methylphenyl)furan-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(OC)cc2)oc(-c2ccc(C)cc2)c1C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C29H26O5/c1-5-33-29(31)25-24(26(30)20-10-6-18(2)7-11-20)27(21-12-8-19(3)9-13-21)34-28(25)22-14-16-23(32-4)17-15-22/h6-17H,5H2,1-4H3 |
| InChIKey | MTVRFBREFOCSRA-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |