About 2-hexyldecan-1-ol;methanesulfonic acid
2-hexyldecan-1-ol;methanesulfonic acid (PubChem CID 71335551) has the molecular formula C17H38O4S
and a molecular weight of 338.55 g/mol. Its IUPAC name is 2-hexyldecan-1-ol;methanesulfonic acid.
Molecular Properties
| Compound Name | 2-hexyldecan-1-ol;methanesulfonic acid |
| PubChem CID | 71335551 |
| Molecular Formula | C17H38O4S |
| Molecular Weight | 338.55 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 2-hexyldecan-1-ol;methanesulfonic acid |
| SMILES | CCCCCCCCC(CO)CCCCCC.CS(=O)(=O)O |
| InChI | InChI=1S/C16H34O.CH4O3S/c1-3-5-7-9-10-12-14-16(15-17)13-11-8-6-4-2;1-5(2,3)4/h16-17H,3-15H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | WDVLYKXHTCSRAN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-hexyldecan-1-ol;methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexyldecan-1-ol;methanesulfonic acid?
The IUPAC name of 2-hexyldecan-1-ol;methanesulfonic acid (CID 71335551) is 2-hexyldecan-1-ol;methanesulfonic acid.
What is the SMILES notation for 2-hexyldecan-1-ol;methanesulfonic acid?
The canonical SMILES for 2-hexyldecan-1-ol;methanesulfonic acid is CCCCCCCCC(CO)CCCCCC.CS(=O)(=O)O.
What is the InChIKey of 2-hexyldecan-1-ol;methanesulfonic acid?
The InChIKey is WDVLYKXHTCSRAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O.CH4O3S/c1-3-5-7-9-10-12-14-16(15-17)13-11-8-6-4-2;1-5(2,3)4/h16-17H,3-15H2,1-2H3;1H3,(H,2,3,4).
What are the key properties of 2-hexyldecan-1-ol;methanesulfonic acid?
2-hexyldecan-1-ol;methanesulfonic acid has a molecular weight of 338.55 g/mol, XLogP of 4.82, 13 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexyldecan-1-ol;methanesulfonic acid is sourced from PubChem (CID 71335551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).