About phenacyl 4-bromobenzenesulfonate
phenacyl 4-bromobenzenesulfonate (PubChem CID 71336543) has the molecular formula C14H11BrO4S
and a molecular weight of 355.21 g/mol. Its IUPAC name is phenacyl 4-bromobenzenesulfonate.
Molecular Properties
| Compound Name | phenacyl 4-bromobenzenesulfonate |
| PubChem CID | 71336543 |
| Molecular Formula | C14H11BrO4S |
| Molecular Weight | 355.21 g/mol |
| Exact Mass | 353.96 |
| IUPAC Name | phenacyl 4-bromobenzenesulfonate |
| SMILES | O=C(COS(=O)(=O)c1ccc(Br)cc1)c1ccccc1 |
| InChI | InChI=1S/C14H11BrO4S/c15-12-6-8-13(9-7-12)20(17,18)19-10-14(16)11-4-2-1-3-5-11/h1-9H,10H2 |
| InChIKey | OOWWLYHCVBCFII-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.21 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze phenacyl 4-bromobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenacyl 4-bromobenzenesulfonate?
The IUPAC name of phenacyl 4-bromobenzenesulfonate (CID 71336543) is phenacyl 4-bromobenzenesulfonate.
What is the SMILES notation for phenacyl 4-bromobenzenesulfonate?
The canonical SMILES for phenacyl 4-bromobenzenesulfonate is O=C(COS(=O)(=O)c1ccc(Br)cc1)c1ccccc1.
What is the InChIKey of phenacyl 4-bromobenzenesulfonate?
The InChIKey is OOWWLYHCVBCFII-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11BrO4S/c15-12-6-8-13(9-7-12)20(17,18)19-10-14(16)11-4-2-1-3-5-11/h1-9H,10H2.
What are the key properties of phenacyl 4-bromobenzenesulfonate?
phenacyl 4-bromobenzenesulfonate has a molecular weight of 355.21 g/mol, XLogP of 3.04, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenacyl 4-bromobenzenesulfonate is sourced from PubChem (CID 71336543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).