C15H19ClO3S — CID 71338060
9-(4-chlorophenyl)sulfonylnon-6-en-2-one (PubChem CID 71338060) has the molecular formula C15H19ClO3S and a molecular weight of 314.83 g/mol. Its IUPAC name is 9-(4-chlorophenyl)sulfonylnon-6-en-2-one.
| Compound Name | 9-(4-chlorophenyl)sulfonylnon-6-en-2-one |
|---|---|
| PubChem CID | 71338060 |
| Molecular Formula | C15H19ClO3S |
| Molecular Weight | 314.83 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 9-(4-chlorophenyl)sulfonylnon-6-en-2-one |
| SMILES | CC(=O)CCCC=CCCS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H19ClO3S/c1-13(17)7-5-3-2-4-6-12-20(18,19)15-10-8-14(16)9-11-15/h2,4,8-11H,3,5-7,12H2,1H3 |
| InChIKey | WWSLBNRBDMBTRN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.83 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|