C11H24N2O5 — CID 71340029
1,3-bis(3-hydroxybutoxymethyl)urea (PubChem CID 71340029) has the molecular formula C11H24N2O5 and a molecular weight of 264.32 g/mol. Its IUPAC name is 1,3-bis(3-hydroxybutoxymethyl)urea.
| Compound Name | 1,3-bis(3-hydroxybutoxymethyl)urea |
|---|---|
| PubChem CID | 71340029 |
| Molecular Formula | C11H24N2O5 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 1,3-bis(3-hydroxybutoxymethyl)urea |
| SMILES | CC(O)CCOCNC(=O)NCOCCC(C)O |
| InChI | InChI=1S/C11H24N2O5/c1-9(14)3-5-17-7-12-11(16)13-8-18-6-4-10(2)15/h9-10,14-15H,3-8H2,1-2H3,(H2,12,13,16) |
| InChIKey | QSLJHBWQENHGMJ-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|