About propan-2-yloxysulfanyl thiohypochlorite
propan-2-yloxysulfanyl thiohypochlorite (PubChem CID 71340651) has the molecular formula C3H7ClOS2
and a molecular weight of 158.68 g/mol. Its IUPAC name is propan-2-yloxysulfanyl thiohypochlorite.
Molecular Properties
| Compound Name | propan-2-yloxysulfanyl thiohypochlorite |
| PubChem CID | 71340651 |
| Molecular Formula | C3H7ClOS2 |
| Molecular Weight | 158.68 g/mol |
| Exact Mass | 157.96 |
| IUPAC Name | propan-2-yloxysulfanyl thiohypochlorite |
| SMILES | CC(C)OSSCl |
| InChI | InChI=1S/C3H7ClOS2/c1-3(2)5-7-6-4/h3H,1-2H3 |
| InChIKey | JQTSAWZMEPSXPV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.68 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yloxysulfanyl thiohypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yloxysulfanyl thiohypochlorite?
The IUPAC name of propan-2-yloxysulfanyl thiohypochlorite (CID 71340651) is propan-2-yloxysulfanyl thiohypochlorite.
What is the SMILES notation for propan-2-yloxysulfanyl thiohypochlorite?
The canonical SMILES for propan-2-yloxysulfanyl thiohypochlorite is CC(C)OSSCl.
What is the InChIKey of propan-2-yloxysulfanyl thiohypochlorite?
The InChIKey is JQTSAWZMEPSXPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7ClOS2/c1-3(2)5-7-6-4/h3H,1-2H3.
What are the key properties of propan-2-yloxysulfanyl thiohypochlorite?
propan-2-yloxysulfanyl thiohypochlorite has a molecular weight of 158.68 g/mol, XLogP of 2.86, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yloxysulfanyl thiohypochlorite is sourced from PubChem (CID 71340651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).