C14H10N2O3 — CID 71345234
2-methoxy-7-methylpyrido[3,2-g]quinoline-5,10-dione (PubChem CID 71345234) has the molecular formula C14H10N2O3 and a molecular weight of 254.24 g/mol. Its IUPAC name is 2-methoxy-7-methylpyrido[3,2-g]quinoline-5,10-dione.
| Compound Name | 2-methoxy-7-methylpyrido[3,2-g]quinoline-5,10-dione |
|---|---|
| PubChem CID | 71345234 |
| Molecular Formula | C14H10N2O3 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 2-methoxy-7-methylpyrido[3,2-g]quinoline-5,10-dione |
| SMILES | COc1ccc2c(n1)C(=O)c1ncc(C)cc1C2=O |
| InChI | InChI=1S/C14H10N2O3/c1-7-5-9-11(15-6-7)14(18)12-8(13(9)17)3-4-10(16-12)19-2/h3-6H,1-2H3 |
| InChIKey | CBSLHGKYHVZQRU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|