C26H40O4S2 — CID 71346103
3,4-dibutoxy-2-[2-(3,4-dibutoxythiophen-2-yl)ethenyl]thiophene (PubChem CID 71346103) has the molecular formula C26H40O4S2 and a molecular weight of 480.74 g/mol. Its IUPAC name is 3,4-dibutoxy-2-[2-(3,4-dibutoxythiophen-2-yl)ethenyl]thiophene.
| Compound Name | 3,4-dibutoxy-2-[2-(3,4-dibutoxythiophen-2-yl)ethenyl]thiophene |
|---|---|
| PubChem CID | 71346103 |
| Molecular Formula | C26H40O4S2 |
| Molecular Weight | 480.74 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | 3,4-dibutoxy-2-[2-(3,4-dibutoxythiophen-2-yl)ethenyl]thiophene |
| SMILES | CCCCOc1csc(C=Cc2scc(OCCCC)c2OCCCC)c1OCCCC |
| InChI | InChI=1S/C26H40O4S2/c1-5-9-15-27-21-19-31-23(25(21)29-17-11-7-3)13-14-24-26(30-18-12-8-4)22(20-32-24)28-16-10-6-2/h13-14,19-20H,5-12,15-18H2,1-4H3 |
| InChIKey | VXIFALGZEMHJRL-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.74 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|