C14H20O2S2 — CID 170905012
3,6-dibutoxythieno[3,2-b]thiophene (PubChem CID 170905012) has the molecular formula C14H20O2S2 and a molecular weight of 284.45 g/mol. Its IUPAC name is 3,6-dibutoxythieno[3,2-b]thiophene.
| Compound Name | 3,6-dibutoxythieno[3,2-b]thiophene |
|---|---|
| PubChem CID | 170905012 |
| Molecular Formula | C14H20O2S2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 3,6-dibutoxythieno[3,2-b]thiophene |
| SMILES | CCCCOc1csc2c(OCCCC)csc12 |
| InChI | InChI=1S/C14H20O2S2/c1-3-5-7-15-11-9-17-14-12(10-18-13(11)14)16-8-6-4-2/h9-10H,3-8H2,1-2H3 |
| InChIKey | YNLMDBKBEWBXQG-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|