C28H43ClO4 — CID 71346244
2-(4-chloro-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-6-methyl-5-methylidene-4-oxoheptanoic acid (PubChem CID 71346244) has the molecular formula C28H43ClO4 and a molecular weight of 479.10 g/mol. Its IUPAC name is 2-(4-chloro-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-6-methyl-5-methylidene-4-oxoheptanoic acid.
| Compound Name | 2-(4-chloro-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-6-methyl-5-methylidene-4-oxoheptanoic acid |
|---|---|
| PubChem CID | 71346244 |
| Molecular Formula | C28H43ClO4 |
| Molecular Weight | 479.10 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | 2-(4-chloro-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-6-methyl-5-methylidene-4-oxoheptanoic acid |
| SMILES | C=C(C(=O)CC(C(=O)O)C1CCC2C3CCC4C(Cl)C(O)CCC4(C)C3CCC12C)C(C)C |
| InChI | InChI=1S/C28H43ClO4/c1-15(2)16(3)24(31)14-18(26(32)33)20-9-8-19-17-6-7-22-25(29)23(30)11-13-28(22,5)21(17)10-12-27(19,20)4/h15,17-23,25,30H,3,6-14H2,1-2,4-5H3,(H,32,33) |
| InChIKey | DHENOLVIJJTNHM-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.10 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|