C12H7Cl3N2O4S — CID 71347765
N-nitro-N-(2,4,6-trichlorophenyl)benzenesulfonamide (PubChem CID 71347765) has the molecular formula C12H7Cl3N2O4S and a molecular weight of 381.62 g/mol. Its IUPAC name is N-nitro-N-(2,4,6-trichlorophenyl)benzenesulfonamide.
| Compound Name | N-nitro-N-(2,4,6-trichlorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 71347765 |
| Molecular Formula | C12H7Cl3N2O4S |
| Molecular Weight | 381.62 g/mol |
| Exact Mass | 379.92 |
| IUPAC Name | N-nitro-N-(2,4,6-trichlorophenyl)benzenesulfonamide |
| SMILES | O=[N+]([O-])N(c1c(Cl)cc(Cl)cc1Cl)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H7Cl3N2O4S/c13-8-6-10(14)12(11(15)7-8)16(17(18)19)22(20,21)9-4-2-1-3-5-9/h1-7H |
| InChIKey | HVSXPUYXJOCOIV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.62 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|