C22H17Cl3N2O6S2 — CID 5117636
N-[4-[acetyl(benzenesulfonyl)amino]-2,3,5-trichlorophenyl]-N-(benzenesulfonyl)acetamide (PubChem CID 5117636) has the molecular formula C22H17Cl3N2O6S2 and a molecular weight of 575.88 g/mol. Its IUPAC name is N-[4-[acetyl(benzenesulfonyl)amino]-2,3,5-trichlorophenyl]-N-(benzenesulfonyl)acetamide.
| Compound Name | N-[4-[acetyl(benzenesulfonyl)amino]-2,3,5-trichlorophenyl]-N-(benzenesulfonyl)acetamide |
|---|---|
| PubChem CID | 5117636 |
| Molecular Formula | C22H17Cl3N2O6S2 |
| Molecular Weight | 575.88 g/mol |
| Exact Mass | 573.96 |
| IUPAC Name | N-[4-[acetyl(benzenesulfonyl)amino]-2,3,5-trichlorophenyl]-N-(benzenesulfonyl)acetamide |
| SMILES | CC(=O)N(c1cc(Cl)c(N(C(C)=O)S(=O)(=O)c2ccccc2)c(Cl)c1Cl)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H17Cl3N2O6S2/c1-14(28)26(34(30,31)16-9-5-3-6-10-16)19-13-18(23)22(21(25)20(19)24)27(15(2)29)35(32,33)17-11-7-4-8-12-17/h3-13H,1-2H3 |
| InChIKey | ZXOPBCZOPADNMZ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.88 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|