C15H11Cl4NO4S — CID 1180628
N-(4-methylphenyl)sulfonyl-N-(2,3,5,6-tetrachloro-4-hydroxyphenyl)acetamide (PubChem CID 1180628) has the molecular formula C15H11Cl4NO4S and a molecular weight of 443.14 g/mol. Its IUPAC name is N-(4-methylphenyl)sulfonyl-N-(2,3,5,6-tetrachloro-4-hydroxyphenyl)acetamide.
| Compound Name | N-(4-methylphenyl)sulfonyl-N-(2,3,5,6-tetrachloro-4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 1180628 |
| Molecular Formula | C15H11Cl4NO4S |
| Molecular Weight | 443.14 g/mol |
| Exact Mass | 440.92 |
| IUPAC Name | N-(4-methylphenyl)sulfonyl-N-(2,3,5,6-tetrachloro-4-hydroxyphenyl)acetamide |
| SMILES | CC(=O)N(c1c(Cl)c(Cl)c(O)c(Cl)c1Cl)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H11Cl4NO4S/c1-7-3-5-9(6-4-7)25(23,24)20(8(2)21)14-10(16)12(18)15(22)13(19)11(14)17/h3-6,22H,1-2H3 |
| InChIKey | GTPGMEKXPBPSPZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.14 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|