C16H12Cl3NO5S — CID 1381610
[4-[acetyl(benzenesulfonyl)amino]-2,3,6-trichlorophenyl] acetate (PubChem CID 1381610) has the molecular formula C16H12Cl3NO5S and a molecular weight of 436.70 g/mol. Its IUPAC name is [4-[acetyl(benzenesulfonyl)amino]-2,3,6-trichlorophenyl] acetate.
| Compound Name | [4-[acetyl(benzenesulfonyl)amino]-2,3,6-trichlorophenyl] acetate |
|---|---|
| PubChem CID | 1381610 |
| Molecular Formula | C16H12Cl3NO5S |
| Molecular Weight | 436.70 g/mol |
| Exact Mass | 434.95 |
| IUPAC Name | [4-[acetyl(benzenesulfonyl)amino]-2,3,6-trichlorophenyl] acetate |
| SMILES | CC(=O)Oc1c(Cl)cc(N(C(C)=O)S(=O)(=O)c2ccccc2)c(Cl)c1Cl |
| InChI | InChI=1S/C16H12Cl3NO5S/c1-9(21)20(26(23,24)11-6-4-3-5-7-11)13-8-12(17)16(25-10(2)22)15(19)14(13)18/h3-8H,1-2H3 |
| InChIKey | ZRURWZKNRIMYAF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.70 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|