C16H16N3O6- — CID 7135459
2-[2-[(4aS)-5,11-dioxo-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepin-3-yl]-2-oxoethoxy]acetate (PubChem CID 7135459) has the molecular formula C16H16N3O6- and a molecular weight of 346.32 g/mol. Its IUPAC name is 2-[2-[(4aS)-5,11-dioxo-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepin-3-yl]-2-oxoethoxy]acetate.
| Compound Name | 2-[2-[(4aS)-5,11-dioxo-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepin-3-yl]-2-oxoethoxy]acetate |
|---|---|
| PubChem CID | 7135459 |
| Molecular Formula | C16H16N3O6- |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 2-[2-[(4aS)-5,11-dioxo-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepin-3-yl]-2-oxoethoxy]acetate |
| SMILES | O=C([O-])COCC(=O)N1CCN2C(=O)c3ccccc3NC(=O)[C@@H]2C1 |
| InChI | InChI=1S/C16H17N3O6/c20-13(8-25-9-14(21)22)18-5-6-19-12(7-18)15(23)17-11-4-2-1-3-10(11)16(19)24/h1-4,12H,5-9H2,(H,17,23)(H,21,22)/p-1/t12-/m0/s1 |
| InChIKey | HCIXEANGNULQFG-LBPRGKRZSA-M |
| XLogP | -1.94 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |