C15H19N4O3+ — CID 7142453
[2-[(4aR)-5,11-dioxo-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepin-3-yl]-2-oxoethyl]-methylazanium (PubChem CID 7142453) has the molecular formula C15H19N4O3+ and a molecular weight of 303.34 g/mol. Its IUPAC name is [2-[(4aR)-5,11-dioxo-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepin-3-yl]-2-oxoethyl]-methylazanium.
| Compound Name | [2-[(4aR)-5,11-dioxo-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepin-3-yl]-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 7142453 |
| Molecular Formula | C15H19N4O3+ |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | [2-[(4aR)-5,11-dioxo-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepin-3-yl]-2-oxoethyl]-methylazanium |
| SMILES | C[NH2+]CC(=O)N1CCN2C(=O)c3ccccc3NC(=O)[C@H]2C1 |
| InChI | InChI=1S/C15H18N4O3/c1-16-8-13(20)18-6-7-19-12(9-18)14(21)17-11-5-3-2-4-10(11)15(19)22/h2-5,12,16H,6-9H2,1H3,(H,17,21)/p+1/t12-/m1/s1 |
| InChIKey | HCZHVYBIHYRBBZ-GFCCVEGCSA-O |
| XLogP | -1.52 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |