C12H8F7NO — CID 71360990
1-anilino-4,4,5,5,6,6,6-heptafluorohex-1-en-3-one (PubChem CID 71360990) has the molecular formula C12H8F7NO and a molecular weight of 315.19 g/mol. Its IUPAC name is 1-anilino-4,4,5,5,6,6,6-heptafluorohex-1-en-3-one.
| Compound Name | 1-anilino-4,4,5,5,6,6,6-heptafluorohex-1-en-3-one |
|---|---|
| PubChem CID | 71360990 |
| Molecular Formula | C12H8F7NO |
| Molecular Weight | 315.19 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 1-anilino-4,4,5,5,6,6,6-heptafluorohex-1-en-3-one |
| SMILES | O=C(C=CNc1ccccc1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H8F7NO/c13-10(14,11(15,16)12(17,18)19)9(21)6-7-20-8-4-2-1-3-5-8/h1-7,20H |
| InChIKey | XFHCDUPPKDNJDY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.19 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|