C11H17NO2S2 — CID 71364444
2-[bis(prop-2-enyl)carbamothioylsulfanyl]-2-methylpropanoic acid (PubChem CID 71364444) has the molecular formula C11H17NO2S2 and a molecular weight of 259.40 g/mol. Its IUPAC name is 2-[bis(prop-2-enyl)carbamothioylsulfanyl]-2-methylpropanoic acid.
| Compound Name | 2-[bis(prop-2-enyl)carbamothioylsulfanyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 71364444 |
| Molecular Formula | C11H17NO2S2 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 2-[bis(prop-2-enyl)carbamothioylsulfanyl]-2-methylpropanoic acid |
| SMILES | C=CCN(CC=C)C(=S)SC(C)(C)C(=O)O |
| InChI | InChI=1S/C11H17NO2S2/c1-5-7-12(8-6-2)10(15)16-11(3,4)9(13)14/h5-6H,1-2,7-8H2,3-4H3,(H,13,14) |
| InChIKey | YJIGLYXSGUKUCZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|