C34H18N4S4 — CID 71366088
2-[2,4,5-tris(1,3-benzothiazol-2-yl)phenyl]-1,3-benzothiazole (PubChem CID 71366088) has the molecular formula C34H18N4S4 and a molecular weight of 610.81 g/mol. Its IUPAC name is 2-[2,4,5-tris(1,3-benzothiazol-2-yl)phenyl]-1,3-benzothiazole.
| Compound Name | 2-[2,4,5-tris(1,3-benzothiazol-2-yl)phenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 71366088 |
| Molecular Formula | C34H18N4S4 |
| Molecular Weight | 610.81 g/mol |
| Exact Mass | 610.04 |
| IUPAC Name | 2-[2,4,5-tris(1,3-benzothiazol-2-yl)phenyl]-1,3-benzothiazole |
| SMILES | c1ccc2sc(-c3cc(-c4nc5ccccc5s4)c(-c4nc5ccccc5s4)cc3-c3nc4ccccc4s3)nc2c1 |
| InChI | InChI=1S/C34H18N4S4/c1-5-13-27-23(9-1)35-31(39-27)19-17-21(33-37-25-11-3-7-15-29(25)41-33)22(34-38-26-12-4-8-16-30(26)42-34)18-20(19)32-36-24-10-2-6-14-28(24)40-32/h1-18H |
| InChIKey | CLKLBYMMBCBUDP-UHFFFAOYSA-N |
| XLogP | 10.79 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.81 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |