C32H22N2P+ — CID 71367326
2-(1,10-phenanthrolin-3-yl)ethynyl-triphenylphosphanium (PubChem CID 71367326) has the molecular formula C32H22N2P+ and a molecular weight of 465.52 g/mol. Its IUPAC name is 2-(1,10-phenanthrolin-3-yl)ethynyl-triphenylphosphanium.
| Compound Name | 2-(1,10-phenanthrolin-3-yl)ethynyl-triphenylphosphanium |
|---|---|
| PubChem CID | 71367326 |
| Molecular Formula | C32H22N2P+ |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 2-(1,10-phenanthrolin-3-yl)ethynyl-triphenylphosphanium |
| SMILES | C(#C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)c1cnc2c(ccc3cccnc32)c1 |
| InChI | InChI=1S/C32H22N2P/c1-4-12-28(13-5-1)35(29-14-6-2-7-15-29,30-16-8-3-9-17-30)22-20-25-23-27-19-18-26-11-10-21-33-31(26)32(27)34-24-25/h1-19,21,23-24H/q+1 |
| InChIKey | WNOVVPKYZFEIND-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|