About 2,2-dichloroethoxymethanol
2,2-dichloroethoxymethanol (PubChem CID 71367680) has the molecular formula C3H6Cl2O2
and a molecular weight of 144.98 g/mol. Its IUPAC name is 2,2-dichloroethoxymethanol.
Molecular Properties
| Compound Name | 2,2-dichloroethoxymethanol |
| PubChem CID | 71367680 |
| Molecular Formula | C3H6Cl2O2 |
| Molecular Weight | 144.98 g/mol |
| Exact Mass | 143.97 |
| IUPAC Name | 2,2-dichloroethoxymethanol |
| SMILES | OCOCC(Cl)Cl |
| InChI | InChI=1S/C3H6Cl2O2/c4-3(5)1-7-2-6/h3,6H,1-2H2 |
| InChIKey | JJMQEJDOKXJXIB-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.98 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dichloroethoxymethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dichloroethoxymethanol?
The IUPAC name of 2,2-dichloroethoxymethanol (CID 71367680) is 2,2-dichloroethoxymethanol.
What is the SMILES notation for 2,2-dichloroethoxymethanol?
The canonical SMILES for 2,2-dichloroethoxymethanol is OCOCC(Cl)Cl.
What is the InChIKey of 2,2-dichloroethoxymethanol?
The InChIKey is JJMQEJDOKXJXIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6Cl2O2/c4-3(5)1-7-2-6/h3,6H,1-2H2.
What are the key properties of 2,2-dichloroethoxymethanol?
2,2-dichloroethoxymethanol has a molecular weight of 144.98 g/mol, XLogP of 0.76, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dichloroethoxymethanol is sourced from PubChem (CID 71367680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).