C14H32O4 — CID 158248678
2,3-dimethylbutoxymethanol (PubChem CID 158248678) has the molecular formula C14H32O4 and a molecular weight of 264.41 g/mol. Its IUPAC name is 2,3-dimethylbutoxymethanol.
| Compound Name | 2,3-dimethylbutoxymethanol |
|---|---|
| PubChem CID | 158248678 |
| Molecular Formula | C14H32O4 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.23 |
| IUPAC Name | 2,3-dimethylbutoxymethanol |
| SMILES | CC(C)C(C)COCO.CC(C)C(C)COCO |
| InChI | InChI=1S/2C7H16O2/c2*1-6(2)7(3)4-9-5-8/h2*6-8H,4-5H2,1-3H3 |
| InChIKey | GGLBSSYXFXRUJJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|