C6H15OP — CID 151975112
2,3-dimethylbutoxyphosphane (PubChem CID 151975112) has the molecular formula C6H15OP and a molecular weight of 134.16 g/mol. Its IUPAC name is 2,3-dimethylbutoxyphosphane.
| Compound Name | 2,3-dimethylbutoxyphosphane |
|---|---|
| PubChem CID | 151975112 |
| Molecular Formula | C6H15OP |
| Molecular Weight | 134.16 g/mol |
| Exact Mass | 134.09 |
| IUPAC Name | 2,3-dimethylbutoxyphosphane |
| SMILES | CC(C)C(C)COP |
| InChI | InChI=1S/C6H15OP/c1-5(2)6(3)4-7-8/h5-6H,4,8H2,1-3H3 |
| InChIKey | BZGTWASXNMNUMO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.16 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|