About (6-butyl-5-oxooxan-2-yl) acetate
(6-butyl-5-oxooxan-2-yl) acetate (PubChem CID 71370202) has the molecular formula C11H18O4
and a molecular weight of 214.26 g/mol. Its IUPAC name is (6-butyl-5-oxooxan-2-yl) acetate.
Molecular Properties
| Compound Name | (6-butyl-5-oxooxan-2-yl) acetate |
| PubChem CID | 71370202 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | (6-butyl-5-oxooxan-2-yl) acetate |
| SMILES | CCCCC1OC(OC(C)=O)CCC1=O |
| InChI | InChI=1S/C11H18O4/c1-3-4-5-10-9(13)6-7-11(15-10)14-8(2)12/h10-11H,3-7H2,1-2H3 |
| InChIKey | YFSURPBTNKZQSK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-butyl-5-oxooxan-2-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-butyl-5-oxooxan-2-yl) acetate?
The IUPAC name of (6-butyl-5-oxooxan-2-yl) acetate (CID 71370202) is (6-butyl-5-oxooxan-2-yl) acetate.
What is the SMILES notation for (6-butyl-5-oxooxan-2-yl) acetate?
The canonical SMILES for (6-butyl-5-oxooxan-2-yl) acetate is CCCCC1OC(OC(C)=O)CCC1=O.
What is the InChIKey of (6-butyl-5-oxooxan-2-yl) acetate?
The InChIKey is YFSURPBTNKZQSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O4/c1-3-4-5-10-9(13)6-7-11(15-10)14-8(2)12/h10-11H,3-7H2,1-2H3.
What are the key properties of (6-butyl-5-oxooxan-2-yl) acetate?
(6-butyl-5-oxooxan-2-yl) acetate has a molecular weight of 214.26 g/mol, XLogP of 1.81, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-butyl-5-oxooxan-2-yl) acetate is sourced from PubChem (CID 71370202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).