C19H32O — CID 71370532
8-tert-butylpentadeca-6,9-diyn-8-ol (PubChem CID 71370532) has the molecular formula C19H32O and a molecular weight of 276.46 g/mol. Its IUPAC name is 8-tert-butylpentadeca-6,9-diyn-8-ol.
| Compound Name | 8-tert-butylpentadeca-6,9-diyn-8-ol |
|---|---|
| PubChem CID | 71370532 |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.25 |
| IUPAC Name | 8-tert-butylpentadeca-6,9-diyn-8-ol |
| SMILES | CCCCCC#CC(O)(C#CCCCCC)C(C)(C)C |
| InChI | InChI=1S/C19H32O/c1-6-8-10-12-14-16-19(20,18(3,4)5)17-15-13-11-9-7-2/h20H,6-13H2,1-5H3 |
| InChIKey | KSFCLUGWRRVPGY-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|