C43H56Br2N2O — CID 71377116
2,7-bis(1-decylpyridin-1-ium-4-yl)fluoren-9-one dibromide (PubChem CID 71377116) has the molecular formula C43H56Br2N2O and a molecular weight of 776.74 g/mol. Its IUPAC name is 2,7-bis(1-decylpyridin-1-ium-4-yl)fluoren-9-one dibromide.
| Compound Name | 2,7-bis(1-decylpyridin-1-ium-4-yl)fluoren-9-one dibromide |
|---|---|
| PubChem CID | 71377116 |
| Molecular Formula | C43H56Br2N2O |
| Molecular Weight | 776.74 g/mol |
| Exact Mass | 774.28 |
| IUPAC Name | 2,7-bis(1-decylpyridin-1-ium-4-yl)fluoren-9-one dibromide |
| SMILES | CCCCCCCCCC[n+]1ccc(-c2ccc3c(c2)C(=O)c2cc(-c4cc[n+](CCCCCCCCCC)cc4)ccc2-3)cc1.[Br-].[Br-] |
| InChI | InChI=1S/C43H56N2O.2BrH/c1-3-5-7-9-11-13-15-17-27-44-29-23-35(24-30-44)37-19-21-39-40-22-20-38(34-42(40)43(46)41(39)33-37)36-25-31-45(32-26-36)28-18-16-14-12-10-8-6-4-2;;/h19-26,29-34H,3-18,27-28H2,1-2H3;2*1H/q+2;;/p-2 |
| InChIKey | QGRVXIUFTXSQMM-UHFFFAOYSA-L |
| XLogP | 5.10 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.74 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|