C16H28O2 — CID 71379608
6-ethenyltetradec-7-yne-1,5-diol (PubChem CID 71379608) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is 6-ethenyltetradec-7-yne-1,5-diol.
| Compound Name | 6-ethenyltetradec-7-yne-1,5-diol |
|---|---|
| PubChem CID | 71379608 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 6-ethenyltetradec-7-yne-1,5-diol |
| SMILES | C=CC(C#CCCCCCC)C(O)CCCCO |
| InChI | InChI=1S/C16H28O2/c1-3-5-6-7-8-9-12-15(4-2)16(18)13-10-11-14-17/h4,15-18H,2-3,5-8,10-11,13-14H2,1H3 |
| InChIKey | ADNSSSPEDMBQMU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|