C14H17NO2 — CID 71379706
5-(2-ethoxyethyl)-4-methyl-2-phenyl-1,3-oxazole (PubChem CID 71379706) has the molecular formula C14H17NO2 and a molecular weight of 231.30 g/mol. Its IUPAC name is 5-(2-ethoxyethyl)-4-methyl-2-phenyl-1,3-oxazole.
| Compound Name | 5-(2-ethoxyethyl)-4-methyl-2-phenyl-1,3-oxazole |
|---|---|
| PubChem CID | 71379706 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 5-(2-ethoxyethyl)-4-methyl-2-phenyl-1,3-oxazole |
| SMILES | CCOCCc1oc(-c2ccccc2)nc1C |
| InChI | InChI=1S/C14H17NO2/c1-3-16-10-9-13-11(2)15-14(17-13)12-7-5-4-6-8-12/h4-8H,3,9-10H2,1-2H3 |
| InChIKey | CFVLZWMYQQBBDB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|