C28H28N3O2+ — CID 7138126
4-(4-benzhydrylpiperazin-4-ium-1-yl)-2-methylquinoline-8-carboxylic acid (PubChem CID 7138126) has the molecular formula C28H28N3O2+ and a molecular weight of 438.55 g/mol. Its IUPAC name is 4-(4-benzhydrylpiperazin-4-ium-1-yl)-2-methylquinoline-8-carboxylic acid.
| Compound Name | 4-(4-benzhydrylpiperazin-4-ium-1-yl)-2-methylquinoline-8-carboxylic acid |
|---|---|
| PubChem CID | 7138126 |
| Molecular Formula | C28H28N3O2+ |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 4-(4-benzhydrylpiperazin-4-ium-1-yl)-2-methylquinoline-8-carboxylic acid |
| SMILES | Cc1cc(N2CC[NH+](C(c3ccccc3)c3ccccc3)CC2)c2cccc(C(=O)O)c2n1 |
| InChI | InChI=1S/C28H27N3O2/c1-20-19-25(23-13-8-14-24(28(32)33)26(23)29-20)30-15-17-31(18-16-30)27(21-9-4-2-5-10-21)22-11-6-3-7-12-22/h2-14,19,27H,15-18H2,1H3,(H,32,33)/p+1 |
| InChIKey | WDDZKXKAYRCSDI-UHFFFAOYSA-O |
| XLogP | 3.74 |
| TPSA | 57.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |