C13H9F3N2O6S2 — CID 71383905
N-[2-(benzenesulfonyl)-5-nitrophenyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 71383905) has the molecular formula C13H9F3N2O6S2 and a molecular weight of 410.35 g/mol. Its IUPAC name is N-[2-(benzenesulfonyl)-5-nitrophenyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[2-(benzenesulfonyl)-5-nitrophenyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 71383905 |
| Molecular Formula | C13H9F3N2O6S2 |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 409.99 |
| IUPAC Name | N-[2-(benzenesulfonyl)-5-nitrophenyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)c2ccccc2)c(NS(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C13H9F3N2O6S2/c14-13(15,16)26(23,24)17-11-8-9(18(19)20)6-7-12(11)25(21,22)10-4-2-1-3-5-10/h1-8,17H |
| InChIKey | IPFMZFUOFDXCMU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 123.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|