About 2-pentylguanidine;sulfuric acid
2-pentylguanidine;sulfuric acid (PubChem CID 71384177) has the molecular formula C6H17N3O4S
and a molecular weight of 227.29 g/mol. Its IUPAC name is 2-pentylguanidine;sulfuric acid.
Molecular Properties
| Compound Name | 2-pentylguanidine;sulfuric acid |
| PubChem CID | 71384177 |
| Molecular Formula | C6H17N3O4S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 2-pentylguanidine;sulfuric acid |
| SMILES | CCCCCN=C(N)N.O=S(=O)(O)O |
| InChI | InChI=1S/C6H15N3.H2O4S/c1-2-3-4-5-9-6(7)8;1-5(2,3)4/h2-5H2,1H3,(H4,7,8,9);(H2,1,2,3,4) |
| InChIKey | VYVOUAXGNRUOCB-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-pentylguanidine;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentylguanidine;sulfuric acid?
The IUPAC name of 2-pentylguanidine;sulfuric acid (CID 71384177) is 2-pentylguanidine;sulfuric acid.
What is the SMILES notation for 2-pentylguanidine;sulfuric acid?
The canonical SMILES for 2-pentylguanidine;sulfuric acid is CCCCCN=C(N)N.O=S(=O)(O)O.
What is the InChIKey of 2-pentylguanidine;sulfuric acid?
The InChIKey is VYVOUAXGNRUOCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N3.H2O4S/c1-2-3-4-5-9-6(7)8;1-5(2,3)4/h2-5H2,1H3,(H4,7,8,9);(H2,1,2,3,4).
What are the key properties of 2-pentylguanidine;sulfuric acid?
2-pentylguanidine;sulfuric acid has a molecular weight of 227.29 g/mol, XLogP of -0.20, 4 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentylguanidine;sulfuric acid is sourced from PubChem (CID 71384177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).