2-pentylguanidine;sulfuric acid

C6H17N3O4S — CID 71384177

IUPAC2-pentylguanidine;sulfuric acid
SMILESCCCCCN=C(N)N.O=S(=O)(O)O
InChIInChI=1S/C6H15N3.H2O4S/c1-2-3-4-5-9-6(7)8;1-5(2,3)4/h2-5H2,1H3,(H4,7,8,9);(H2,1,2,3,4)
InChIKeyVYVOUAXGNRUOCB-UHFFFAOYSA-N
MW227.29 g/mol
LogP-0.20
Rot. Bonds4

About 2-pentylguanidine;sulfuric acid

2-pentylguanidine;sulfuric acid (PubChem CID 71384177) has the molecular formula C6H17N3O4S and a molecular weight of 227.29 g/mol. Its IUPAC name is 2-pentylguanidine;sulfuric acid.

Molecular Properties

Compound Name2-pentylguanidine;sulfuric acid
PubChem CID71384177
Molecular FormulaC6H17N3O4S
Molecular Weight227.29 g/mol
Exact Mass227.09
IUPAC Name2-pentylguanidine;sulfuric acid
SMILESCCCCCN=C(N)N.O=S(=O)(O)O
InChIInChI=1S/C6H15N3.H2O4S/c1-2-3-4-5-9-6(7)8;1-5(2,3)4/h2-5H2,1H3,(H4,7,8,9);(H2,1,2,3,4)
InChIKeyVYVOUAXGNRUOCB-UHFFFAOYSA-N
XLogP-0.20
TPSA139.00 Ų
H-Bond Donors4
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.29
LogP ≤ 5-0.20
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-pentylguanidine;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-pentylguanidine;sulfuric acid?
The IUPAC name of 2-pentylguanidine;sulfuric acid (CID 71384177) is 2-pentylguanidine;sulfuric acid.
What is the SMILES notation for 2-pentylguanidine;sulfuric acid?
The canonical SMILES for 2-pentylguanidine;sulfuric acid is CCCCCN=C(N)N.O=S(=O)(O)O.
What is the InChIKey of 2-pentylguanidine;sulfuric acid?
The InChIKey is VYVOUAXGNRUOCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N3.H2O4S/c1-2-3-4-5-9-6(7)8;1-5(2,3)4/h2-5H2,1H3,(H4,7,8,9);(H2,1,2,3,4).
What are the key properties of 2-pentylguanidine;sulfuric acid?
2-pentylguanidine;sulfuric acid has a molecular weight of 227.29 g/mol, XLogP of -0.20, 4 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentylguanidine;sulfuric acid is sourced from PubChem (CID 71384177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).