C20H33BO — CID 71386165
9-(4,4-dimethyldec-2-en-5-yn-2-yloxy)-9-borabicyclo[3.3.1]nonane (PubChem CID 71386165) has the molecular formula C20H33BO and a molecular weight of 300.30 g/mol. Its IUPAC name is 9-(4,4-dimethyldec-2-en-5-yn-2-yloxy)-9-borabicyclo[3.3.1]nonane.
| Compound Name | 9-(4,4-dimethyldec-2-en-5-yn-2-yloxy)-9-borabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 71386165 |
| Molecular Formula | C20H33BO |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.26 |
| IUPAC Name | 9-(4,4-dimethyldec-2-en-5-yn-2-yloxy)-9-borabicyclo[3.3.1]nonane |
| SMILES | CCCCC#CC(C)(C)C=C(C)OB1C2CCCC1CCC2 |
| InChI | InChI=1S/C20H33BO/c1-5-6-7-8-15-20(3,4)16-17(2)22-21-18-11-9-12-19(21)14-10-13-18/h16,18-19H,5-7,9-14H2,1-4H3 |
| InChIKey | KWIAIUGFDZJRAD-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|