C7H8Cl6OS — CID 71387453
S-(5,5,5-trichloropentyl) 2,2,2-trichloroethanethioate (PubChem CID 71387453) has the molecular formula C7H8Cl6OS and a molecular weight of 352.93 g/mol. Its IUPAC name is S-(5,5,5-trichloropentyl) 2,2,2-trichloroethanethioate.
| Compound Name | S-(5,5,5-trichloropentyl) 2,2,2-trichloroethanethioate |
|---|---|
| PubChem CID | 71387453 |
| Molecular Formula | C7H8Cl6OS |
| Molecular Weight | 352.93 g/mol |
| Exact Mass | 349.84 |
| IUPAC Name | S-(5,5,5-trichloropentyl) 2,2,2-trichloroethanethioate |
| SMILES | O=C(SCCCCC(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C7H8Cl6OS/c8-6(9,10)3-1-2-4-15-5(14)7(11,12)13/h1-4H2 |
| InChIKey | AAYOPVWUNSOFBZ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.93 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|