2-[dichloro(1,3-dicarboxypropyl)stannyl]pentanedioic acid

C10H14Cl2O8Sn — CID 71388022

IUPAC2-[dichloro(1,3-dicarboxypropyl)stannyl]pentanedioic acid
SMILESO=C(O)CCC(C(=O)O)[Sn](Cl)(Cl)C(CCC(=O)O)C(=O)O
InChIInChI=1S/2C5H7O4.2ClH.Sn/c2*6-4(7)2-1-3-5(8)9;;;/h2*2H,1,3H2,(H,6,7)(H,8,9);2*1H;/q;;;;+2/p-2
InChIKeyORMXZOFGTBMVTF-UHFFFAOYSA-L
MW451.83 g/mol
LogP1.55
Rot. Bonds10

About 2-[dichloro(1,3-dicarboxypropyl)stannyl]pentanedioic acid

2-[dichloro(1,3-dicarboxypropyl)stannyl]pentanedioic acid (PubChem CID 71388022) has the molecular formula C10H14Cl2O8Sn and a molecular weight of 451.83 g/mol. Its IUPAC name is 2-[dichloro(1,3-dicarboxypropyl)stannyl]pentanedioic acid.

Molecular Properties

Compound Name2-[dichloro(1,3-dicarboxypropyl)stannyl]pentanedioic acid
PubChem CID71388022
Molecular FormulaC10H14Cl2O8Sn
Molecular Weight451.83 g/mol
Exact Mass451.91
IUPAC Name2-[dichloro(1,3-dicarboxypropyl)stannyl]pentanedioic acid
SMILESO=C(O)CCC(C(=O)O)[Sn](Cl)(Cl)C(CCC(=O)O)C(=O)O
InChIInChI=1S/2C5H7O4.2ClH.Sn/c2*6-4(7)2-1-3-5(8)9;;;/h2*2H,1,3H2,(H,6,7)(H,8,9);2*1H;/q;;;;+2/p-2
InChIKeyORMXZOFGTBMVTF-UHFFFAOYSA-L
XLogP1.55
TPSA149.20 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds10
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500451.83
LogP ≤ 51.55
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze 2-[dichloro(1,3-dicarboxypropyl)stannyl]pentanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[dichloro(1,3-dicarboxypropyl)stannyl]pentanedioic acid?
The IUPAC name of 2-[dichloro(1,3-dicarboxypropyl)stannyl]pentanedioic acid (CID 71388022) is 2-[dichloro(1,3-dicarboxypropyl)stannyl]pentanedioic acid.
What is the SMILES notation for 2-[dichloro(1,3-dicarboxypropyl)stannyl]pentanedioic acid?
The canonical SMILES for 2-[dichloro(1,3-dicarboxypropyl)stannyl]pentanedioic acid is O=C(O)CCC(C(=O)O)[Sn](Cl)(Cl)C(CCC(=O)O)C(=O)O.
What is the InChIKey of 2-[dichloro(1,3-dicarboxypropyl)stannyl]pentanedioic acid?
The InChIKey is ORMXZOFGTBMVTF-UHFFFAOYSA-L. The full InChI is InChI=1S/2C5H7O4.2ClH.Sn/c2*6-4(7)2-1-3-5(8)9;;;/h2*2H,1,3H2,(H,6,7)(H,8,9);2*1H;/q;;;;+2/p-2.
What are the key properties of 2-[dichloro(1,3-dicarboxypropyl)stannyl]pentanedioic acid?
2-[dichloro(1,3-dicarboxypropyl)stannyl]pentanedioic acid has a molecular weight of 451.83 g/mol, XLogP of 1.55, 10 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[dichloro(1,3-dicarboxypropyl)stannyl]pentanedioic acid is sourced from PubChem (CID 71388022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).