C17H16O2S2 — CID 71390137
(3R,4S)-3,4-dimethoxyspiro[thietane-2,9'-thioxanthene] (PubChem CID 71390137) has the molecular formula C17H16O2S2 and a molecular weight of 316.45 g/mol. Its IUPAC name is (3R,4S)-3,4-dimethoxyspiro[thietane-2,9'-thioxanthene].
| Compound Name | (3R,4S)-3,4-dimethoxyspiro[thietane-2,9'-thioxanthene] |
|---|---|
| PubChem CID | 71390137 |
| Molecular Formula | C17H16O2S2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | (3R,4S)-3,4-dimethoxyspiro[thietane-2,9'-thioxanthene] |
| SMILES | CO[C@H]1SC2(c3ccccc3Sc3ccccc32)[C@H]1OC |
| InChI | InChI=1S/C17H16O2S2/c1-18-15-16(19-2)21-17(15)11-7-3-5-9-13(11)20-14-10-6-4-8-12(14)17/h3-10,15-16H,1-2H3/t15-,16-/m0/s1 |
| InChIKey | AFOZHSSSQOANHY-HOTGVXAUSA-N |
| XLogP | 4.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |