C9H8N4O2 — CID 71390982
2-(pyridin-2-ylmethyl)-1,2,4-triazine-3,5-dione (PubChem CID 71390982) has the molecular formula C9H8N4O2 and a molecular weight of 204.19 g/mol. Its IUPAC name is 2-(pyridin-2-ylmethyl)-1,2,4-triazine-3,5-dione.
| Compound Name | 2-(pyridin-2-ylmethyl)-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 71390982 |
| Molecular Formula | C9H8N4O2 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 2-(pyridin-2-ylmethyl)-1,2,4-triazine-3,5-dione |
| SMILES | O=c1cnn(Cc2ccccn2)c(=O)[nH]1 |
| InChI | InChI=1S/C9H8N4O2/c14-8-5-11-13(9(15)12-8)6-7-3-1-2-4-10-7/h1-5H,6H2,(H,12,14,15) |
| InChIKey | AJAAFXMRSVXARO-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |