C11H6F5NO3 — CID 71391668
2,3-difluoro-3-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]prop-2-enoic acid (PubChem CID 71391668) has the molecular formula C11H6F5NO3 and a molecular weight of 295.16 g/mol. Its IUPAC name is 2,3-difluoro-3-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]prop-2-enoic acid.
| Compound Name | 2,3-difluoro-3-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 71391668 |
| Molecular Formula | C11H6F5NO3 |
| Molecular Weight | 295.16 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 2,3-difluoro-3-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C(F)=C(F)c1ccc(NC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H6F5NO3/c12-7(8(13)9(18)19)5-1-3-6(4-2-5)17-10(20)11(14,15)16/h1-4H,(H,17,20)(H,18,19) |
| InChIKey | NQKDCVRPWGYOOH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.16 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|