C12H7Cl2N5O2 — CID 71392924
4,7-dichloro-2-(1-methyl-5-nitroimidazol-2-yl)quinazoline (PubChem CID 71392924) has the molecular formula C12H7Cl2N5O2 and a molecular weight of 324.13 g/mol. Its IUPAC name is 4,7-dichloro-2-(1-methyl-5-nitroimidazol-2-yl)quinazoline.
| Compound Name | 4,7-dichloro-2-(1-methyl-5-nitroimidazol-2-yl)quinazoline |
|---|---|
| PubChem CID | 71392924 |
| Molecular Formula | C12H7Cl2N5O2 |
| Molecular Weight | 324.13 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | 4,7-dichloro-2-(1-methyl-5-nitroimidazol-2-yl)quinazoline |
| SMILES | Cn1c([N+](=O)[O-])cnc1-c1nc(Cl)c2ccc(Cl)cc2n1 |
| InChI | InChI=1S/C12H7Cl2N5O2/c1-18-9(19(20)21)5-15-12(18)11-16-8-4-6(13)2-3-7(8)10(14)17-11/h2-5H,1H3 |
| InChIKey | IBBCGIMHAVKVQZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.13 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|