C18H21ClN6O2 — CID 71588239
N-(7-chloroquinolin-4-yl)-N'-methyl-N'-[2-(2-methyl-5-nitroimidazol-1-yl)ethyl]ethane-1,2-diamine (PubChem CID 71588239) has the molecular formula C18H21ClN6O2 and a molecular weight of 388.86 g/mol. Its IUPAC name is N-(7-chloroquinolin-4-yl)-N'-methyl-N'-[2-(2-methyl-5-nitroimidazol-1-yl)ethyl]ethane-1,2-diamine.
| Compound Name | N-(7-chloroquinolin-4-yl)-N'-methyl-N'-[2-(2-methyl-5-nitroimidazol-1-yl)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 71588239 |
| Molecular Formula | C18H21ClN6O2 |
| Molecular Weight | 388.86 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | N-(7-chloroquinolin-4-yl)-N'-methyl-N'-[2-(2-methyl-5-nitroimidazol-1-yl)ethyl]ethane-1,2-diamine |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCN(C)CCNc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C18H21ClN6O2/c1-13-22-12-18(25(26)27)24(13)10-9-23(2)8-7-21-16-5-6-20-17-11-14(19)3-4-15(16)17/h3-6,11-12H,7-10H2,1-2H3,(H,20,21) |
| InChIKey | OLJDIZLKBFIJDL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.86 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|