C19H24ClN7O2 — CID 118735256
2-[4-[[2-[2-[(7-chloroquinolin-4-yl)amino]ethyl-methylamino]ethylamino]methyl]triazol-1-yl]acetic acid (PubChem CID 118735256) has the molecular formula C19H24ClN7O2 and a molecular weight of 417.90 g/mol. Its IUPAC name is 2-[4-[[2-[2-[(7-chloroquinolin-4-yl)amino]ethyl-methylamino]ethylamino]methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[2-[2-[(7-chloroquinolin-4-yl)amino]ethyl-methylamino]ethylamino]methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 118735256 |
| Molecular Formula | C19H24ClN7O2 |
| Molecular Weight | 417.90 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 2-[4-[[2-[2-[(7-chloroquinolin-4-yl)amino]ethyl-methylamino]ethylamino]methyl]triazol-1-yl]acetic acid |
| SMILES | CN(CCNCc1cn(CC(=O)O)nn1)CCNc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C19H24ClN7O2/c1-26(8-6-21-11-15-12-27(25-24-15)13-19(28)29)9-7-23-17-4-5-22-18-10-14(20)2-3-16(17)18/h2-5,10,12,21H,6-9,11,13H2,1H3,(H,22,23)(H,28,29) |
| InChIKey | ZHOCQLQIPOWPDH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 108.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.90 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|