C23H22ClN5O2 — CID 53358436
1-[4-[[1-[3-[(7-chloroquinolin-4-yl)amino]propyl]triazol-4-yl]methoxy]phenyl]ethanone (PubChem CID 53358436) has the molecular formula C23H22ClN5O2 and a molecular weight of 435.92 g/mol. Its IUPAC name is 1-[4-[[1-[3-[(7-chloroquinolin-4-yl)amino]propyl]triazol-4-yl]methoxy]phenyl]ethanone.
| Compound Name | 1-[4-[[1-[3-[(7-chloroquinolin-4-yl)amino]propyl]triazol-4-yl]methoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 53358436 |
| Molecular Formula | C23H22ClN5O2 |
| Molecular Weight | 435.92 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 1-[4-[[1-[3-[(7-chloroquinolin-4-yl)amino]propyl]triazol-4-yl]methoxy]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(OCc2cn(CCCNc3ccnc4cc(Cl)ccc34)nn2)cc1 |
| InChI | InChI=1S/C23H22ClN5O2/c1-16(30)17-3-6-20(7-4-17)31-15-19-14-29(28-27-19)12-2-10-25-22-9-11-26-23-13-18(24)5-8-21(22)23/h3-9,11,13-14H,2,10,12,15H2,1H3,(H,25,26) |
| InChIKey | AGMXXZWDKRKLCN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.92 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|