C37H34ClN5O3 — CID 134816414
(E)-1-[4-[5-[4-[[4-[(7-chloroquinolin-4-yl)amino]phenoxy]methyl]triazol-1-yl]pentoxy]phenyl]-3-cyclopenta-1,4-dien-1-ylprop-2-en-1-one (PubChem CID 134816414) has the molecular formula C37H34ClN5O3 and a molecular weight of 632.16 g/mol. Its IUPAC name is (E)-1-[4-[5-[4-[[4-[(7-chloroquinolin-4-yl)amino]phenoxy]methyl]triazol-1-yl]pentoxy]phenyl]-3-cyclopenta-1,4-dien-1-ylprop-2-en-1-one.
| Compound Name | (E)-1-[4-[5-[4-[[4-[(7-chloroquinolin-4-yl)amino]phenoxy]methyl]triazol-1-yl]pentoxy]phenyl]-3-cyclopenta-1,4-dien-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 134816414 |
| Molecular Formula | C37H34ClN5O3 |
| Molecular Weight | 632.16 g/mol |
| Exact Mass | 631.24 |
| IUPAC Name | (E)-1-[4-[5-[4-[[4-[(7-chloroquinolin-4-yl)amino]phenoxy]methyl]triazol-1-yl]pentoxy]phenyl]-3-cyclopenta-1,4-dien-1-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/C1=CCC=C1)c1ccc(OCCCCCn2cc(COc3ccc(Nc4ccnc5cc(Cl)ccc45)cc3)nn2)cc1 |
| InChI | InChI=1S/C37H34ClN5O3/c38-29-11-18-34-35(20-21-39-36(34)24-29)40-30-12-16-33(17-13-30)46-26-31-25-43(42-41-31)22-4-1-5-23-45-32-14-9-28(10-15-32)37(44)19-8-27-6-2-3-7-27/h2,6-21,24-25H,1,3-5,22-23,26H2,(H,39,40)/b19-8+ |
| InChIKey | YUBSEXUZFBKYBA-UFWORHAWSA-N |
| XLogP | 8.68 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.16 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|