C36H32ClN5O3 — CID 134816412
(E)-1-[4-[4-[4-[[4-[(7-chloroquinolin-4-yl)amino]phenoxy]methyl]triazol-1-yl]butoxy]phenyl]-3-cyclopenta-1,4-dien-1-ylprop-2-en-1-one (PubChem CID 134816412) has the molecular formula C36H32ClN5O3 and a molecular weight of 618.14 g/mol. Its IUPAC name is (E)-1-[4-[4-[4-[[4-[(7-chloroquinolin-4-yl)amino]phenoxy]methyl]triazol-1-yl]butoxy]phenyl]-3-cyclopenta-1,4-dien-1-ylprop-2-en-1-one.
| Compound Name | (E)-1-[4-[4-[4-[[4-[(7-chloroquinolin-4-yl)amino]phenoxy]methyl]triazol-1-yl]butoxy]phenyl]-3-cyclopenta-1,4-dien-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 134816412 |
| Molecular Formula | C36H32ClN5O3 |
| Molecular Weight | 618.14 g/mol |
| Exact Mass | 617.22 |
| IUPAC Name | (E)-1-[4-[4-[4-[[4-[(7-chloroquinolin-4-yl)amino]phenoxy]methyl]triazol-1-yl]butoxy]phenyl]-3-cyclopenta-1,4-dien-1-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/C1=CCC=C1)c1ccc(OCCCCn2cc(COc3ccc(Nc4ccnc5cc(Cl)ccc45)cc3)nn2)cc1 |
| InChI | InChI=1S/C36H32ClN5O3/c37-28-10-17-33-34(19-20-38-35(33)23-28)39-29-11-15-32(16-12-29)45-25-30-24-42(41-40-30)21-3-4-22-44-31-13-8-27(9-14-31)36(43)18-7-26-5-1-2-6-26/h1,5-20,23-24H,2-4,21-22,25H2,(H,38,39)/b18-7+ |
| InChIKey | OOJYMXANHMLMPY-CNHKJKLMSA-N |
| XLogP | 8.29 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.14 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|