C20H24ClN5O — CID 53375666
1-[1-[3-[(7-chloroquinolin-4-yl)amino]propyl]triazol-4-yl]cyclohexan-1-ol (PubChem CID 53375666) has the molecular formula C20H24ClN5O and a molecular weight of 385.90 g/mol. Its IUPAC name is 1-[1-[3-[(7-chloroquinolin-4-yl)amino]propyl]triazol-4-yl]cyclohexan-1-ol.
| Compound Name | 1-[1-[3-[(7-chloroquinolin-4-yl)amino]propyl]triazol-4-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 53375666 |
| Molecular Formula | C20H24ClN5O |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 1-[1-[3-[(7-chloroquinolin-4-yl)amino]propyl]triazol-4-yl]cyclohexan-1-ol |
| SMILES | OC1(c2cn(CCCNc3ccnc4cc(Cl)ccc34)nn2)CCCCC1 |
| InChI | InChI=1S/C20H24ClN5O/c21-15-5-6-16-17(7-11-23-18(16)13-15)22-10-4-12-26-14-19(24-25-26)20(27)8-2-1-3-9-20/h5-7,11,13-14,27H,1-4,8-10,12H2,(H,22,23) |
| InChIKey | FAZFIHSKDOXUJU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|