C19H23ClN6O2 — CID 71588220
N-(7-chloroquinolin-4-yl)-N'-methyl-N'-[2-(2-methyl-5-nitroimidazol-1-yl)ethyl]propane-1,3-diamine (PubChem CID 71588220) has the molecular formula C19H23ClN6O2 and a molecular weight of 402.89 g/mol. Its IUPAC name is N-(7-chloroquinolin-4-yl)-N'-methyl-N'-[2-(2-methyl-5-nitroimidazol-1-yl)ethyl]propane-1,3-diamine.
| Compound Name | N-(7-chloroquinolin-4-yl)-N'-methyl-N'-[2-(2-methyl-5-nitroimidazol-1-yl)ethyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 71588220 |
| Molecular Formula | C19H23ClN6O2 |
| Molecular Weight | 402.89 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | N-(7-chloroquinolin-4-yl)-N'-methyl-N'-[2-(2-methyl-5-nitroimidazol-1-yl)ethyl]propane-1,3-diamine |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCN(C)CCCNc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C19H23ClN6O2/c1-14-23-13-19(26(27)28)25(14)11-10-24(2)9-3-7-21-17-6-8-22-18-12-15(20)4-5-16(17)18/h4-6,8,12-13H,3,7,9-11H2,1-2H3,(H,21,22) |
| InChIKey | YZSBLBGSRJXUJG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.89 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|