C18H26 — CID 71396039
9-ethynyl-6,9-dimethyltetradeca-1,6,7,13-tetraene (PubChem CID 71396039) has the molecular formula C18H26 and a molecular weight of 242.41 g/mol. Its IUPAC name is 9-ethynyl-6,9-dimethyltetradeca-1,6,7,13-tetraene.
| Compound Name | 9-ethynyl-6,9-dimethyltetradeca-1,6,7,13-tetraene |
|---|---|
| PubChem CID | 71396039 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 9-ethynyl-6,9-dimethyltetradeca-1,6,7,13-tetraene |
| SMILES | C#CC(C)(C=C=C(C)CCCC=C)CCCC=C |
| InChI | InChI=1S/C18H26/c1-6-9-11-13-17(4)14-16-18(5,8-3)15-12-10-7-2/h3,6-7,16H,1-2,9-13,15H2,4-5H3 |
| InChIKey | UHEZSYHIKGKCLR-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|