acetic acid;3,4-bis(1,3-benzodioxol-5-ylmethyl)oxolan-2-ol

C22H24O8 — CID 71402885

IUPACacetic acid;3,4-bis(1,3-benzodioxol-5-ylmethyl)oxolan-2-ol
SMILESCC(=O)O.OC1OCC(Cc2ccc3c(c2)OCO3)C1Cc1ccc2c(c1)OCO2
InChIInChI=1S/C20H20O6.C2H4O2/c21-20-15(6-13-2-4-17-19(8-13)26-11-24-17)14(9-22-20)5-12-1-3-16-18(7-12)25-10-23-16;1-2(3)4/h1-4,7-8,14-15,20-21H,5-6,9-11H2;1H3,(H,3,4)
InChIKeyBMLVDHROVGJWAA-UHFFFAOYSA-N
MW416.43 g/mol
LogP2.60
Rot. Bonds4

About acetic acid;3,4-bis(1,3-benzodioxol-5-ylmethyl)oxolan-2-ol

acetic acid;3,4-bis(1,3-benzodioxol-5-ylmethyl)oxolan-2-ol (PubChem CID 71402885) has the molecular formula C22H24O8 and a molecular weight of 416.43 g/mol. Its IUPAC name is acetic acid;3,4-bis(1,3-benzodioxol-5-ylmethyl)oxolan-2-ol.

Molecular Properties

Compound Nameacetic acid;3,4-bis(1,3-benzodioxol-5-ylmethyl)oxolan-2-ol
PubChem CID71402885
Molecular FormulaC22H24O8
Molecular Weight416.43 g/mol
Exact Mass416.15
IUPAC Nameacetic acid;3,4-bis(1,3-benzodioxol-5-ylmethyl)oxolan-2-ol
SMILESCC(=O)O.OC1OCC(Cc2ccc3c(c2)OCO3)C1Cc1ccc2c(c1)OCO2
InChIInChI=1S/C20H20O6.C2H4O2/c21-20-15(6-13-2-4-17-19(8-13)26-11-24-17)14(9-22-20)5-12-1-3-16-18(7-12)25-10-23-16;1-2(3)4/h1-4,7-8,14-15,20-21H,5-6,9-11H2;1H3,(H,3,4)
InChIKeyBMLVDHROVGJWAA-UHFFFAOYSA-N
XLogP2.60
TPSA103.68 Ų
H-Bond Donors2
H-Bond Acceptors7
Rotatable Bonds4
Heavy Atoms30
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500416.43
LogP ≤ 52.60
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 107

Analyze acetic acid;3,4-bis(1,3-benzodioxol-5-ylmethyl)oxolan-2-ol with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;3,4-bis(1,3-benzodioxol-5-ylmethyl)oxolan-2-ol?
The IUPAC name of acetic acid;3,4-bis(1,3-benzodioxol-5-ylmethyl)oxolan-2-ol (CID 71402885) is acetic acid;3,4-bis(1,3-benzodioxol-5-ylmethyl)oxolan-2-ol.
What is the SMILES notation for acetic acid;3,4-bis(1,3-benzodioxol-5-ylmethyl)oxolan-2-ol?
The canonical SMILES for acetic acid;3,4-bis(1,3-benzodioxol-5-ylmethyl)oxolan-2-ol is CC(=O)O.OC1OCC(Cc2ccc3c(c2)OCO3)C1Cc1ccc2c(c1)OCO2.
What is the InChIKey of acetic acid;3,4-bis(1,3-benzodioxol-5-ylmethyl)oxolan-2-ol?
The InChIKey is BMLVDHROVGJWAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20O6.C2H4O2/c21-20-15(6-13-2-4-17-19(8-13)26-11-24-17)14(9-22-20)5-12-1-3-16-18(7-12)25-10-23-16;1-2(3)4/h1-4,7-8,14-15,20-21H,5-6,9-11H2;1H3,(H,3,4).
What are the key properties of acetic acid;3,4-bis(1,3-benzodioxol-5-ylmethyl)oxolan-2-ol?
acetic acid;3,4-bis(1,3-benzodioxol-5-ylmethyl)oxolan-2-ol has a molecular weight of 416.43 g/mol, XLogP of 2.60, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;3,4-bis(1,3-benzodioxol-5-ylmethyl)oxolan-2-ol is sourced from PubChem (CID 71402885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).