C22H26O5 — CID 142808443
5-[[(3R,4R)-4-[[4-(methoxymethoxy)phenyl]methyl]-2-methyloxolan-3-yl]methyl]-1,3-benzodioxole (PubChem CID 142808443) has the molecular formula C22H26O5 and a molecular weight of 370.45 g/mol. Its IUPAC name is 5-[[(3R,4R)-4-[[4-(methoxymethoxy)phenyl]methyl]-2-methyloxolan-3-yl]methyl]-1,3-benzodioxole.
| Compound Name | 5-[[(3R,4R)-4-[[4-(methoxymethoxy)phenyl]methyl]-2-methyloxolan-3-yl]methyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 142808443 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 5-[[(3R,4R)-4-[[4-(methoxymethoxy)phenyl]methyl]-2-methyloxolan-3-yl]methyl]-1,3-benzodioxole |
| SMILES | COCOc1ccc(C[C@H]2COC(C)[C@@H]2Cc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C22H26O5/c1-15-20(10-17-5-8-21-22(11-17)27-14-26-21)18(12-24-15)9-16-3-6-19(7-4-16)25-13-23-2/h3-8,11,15,18,20H,9-10,12-14H2,1-2H3/t15?,18-,20-/m0/s1 |
| InChIKey | DFHRSWIXYXYXIJ-AKPNPTIESA-N |
| XLogP | 3.83 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|